C21H29N3O2 — CID 166612327
1-cyclopentyl-4-[2-(pyrrolidin-3-ylmethyl)benzoyl]piperazin-2-one (PubChem CID 166612327) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-cyclopentyl-4-[2-(pyrrolidin-3-ylmethyl)benzoyl]piperazin-2-one.
| Compound Name | 1-cyclopentyl-4-[2-(pyrrolidin-3-ylmethyl)benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 166612327 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 1-cyclopentyl-4-[2-(pyrrolidin-3-ylmethyl)benzoyl]piperazin-2-one |
| SMILES | O=C(c1ccccc1CC1CCNC1)N1CCN(C2CCCC2)C(=O)C1 |
| InChI | InChI=1S/C21H29N3O2/c25-20-15-23(11-12-24(20)18-6-2-3-7-18)21(26)19-8-4-1-5-17(19)13-16-9-10-22-14-16/h1,4-5,8,16,18,22H,2-3,6-7,9-15H2 |
| InChIKey | AOLYTENTIMSZFG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |