C14H13F4N3O3S — CID 134705610
N-[5-(1-methoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 134705610) has the molecular formula C14H13F4N3O3S and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[5-(1-methoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-[5-(1-methoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 134705610 |
| Molecular Formula | C14H13F4N3O3S |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[5-(1-methoxyethyl)-1,3,4-thiadiazol-2-yl]-2-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | COC(C)c1nnc(NC(=O)c2ccccc2OC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C14H13F4N3O3S/c1-7(23-2)11-20-21-13(25-11)19-10(22)8-5-3-4-6-9(8)24-14(17,18)12(15)16/h3-7,12H,1-2H3,(H,19,21,22) |
| InChIKey | YOFBSONQXMXERT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|