C21H30N4O — CID 134706145
2-(1-benzylpiperidin-4-yl)-N-(5-methyl-2-propylpyrazol-3-yl)acetamide (PubChem CID 134706145) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-N-(5-methyl-2-propylpyrazol-3-yl)acetamide.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-N-(5-methyl-2-propylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 134706145 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-N-(5-methyl-2-propylpyrazol-3-yl)acetamide |
| SMILES | CCCn1nc(C)cc1NC(=O)CC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4O/c1-3-11-25-20(14-17(2)23-25)22-21(26)15-18-9-12-24(13-10-18)16-19-7-5-4-6-8-19/h4-8,14,18H,3,9-13,15-16H2,1-2H3,(H,22,26) |
| InChIKey | BOUVOJHXLDQZJG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |