C20H22N2O2 — CID 134706619
1-[(2S,6R)-2-cyclopropyl-6-phenylmorpholin-4-yl]-2-pyridin-3-ylethanone (PubChem CID 134706619) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[(2S,6R)-2-cyclopropyl-6-phenylmorpholin-4-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(2S,6R)-2-cyclopropyl-6-phenylmorpholin-4-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 134706619 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(2S,6R)-2-cyclopropyl-6-phenylmorpholin-4-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1C[C@@H](c2ccccc2)O[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C20H22N2O2/c23-20(11-15-5-4-10-21-12-15)22-13-18(16-6-2-1-3-7-16)24-19(14-22)17-8-9-17/h1-7,10,12,17-19H,8-9,11,13-14H2/t18-,19+/m0/s1 |
| InChIKey | FNNIDYDNLVBFJM-RBUKOAKNSA-N |
| XLogP | 3.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |