C24H29N3O — CID 166617541
1-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyridin-3-ylethanone (PubChem CID 166617541) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 166617541 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-2-pyridin-3-ylethanone |
| SMILES | O=C(Cc1cccnc1)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](c3ccccc3)N1C2 |
| InChI | InChI=1S/C24H29N3O/c28-24(13-18-6-5-11-25-14-18)26-15-19-12-21(17-26)23-10-4-9-22(27(23)16-19)20-7-2-1-3-8-20/h1-3,5-8,11,14,19,21-23H,4,9-10,12-13,15-17H2/t19-,21+,22+,23-/m0/s1 |
| InChIKey | PKZGKOYHDVJQNE-IZBOUPIGSA-N |
| XLogP | 3.70 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |