C23H26N6O — CID 166620351
[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone (PubChem CID 166620351) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 166620351 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
| SMILES | O=C(c1nc2ncccn2n1)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](c3ccccc3)N1C2 |
| InChI | InChI=1S/C23H26N6O/c30-22(21-25-23-24-10-5-11-29(23)26-21)27-13-16-12-18(15-27)20-9-4-8-19(28(20)14-16)17-6-2-1-3-7-17/h1-3,5-7,10-11,16,18-20H,4,8-9,12-15H2/t16-,18+,19+,20-/m0/s1 |
| InChIKey | YALBPDVBSRDZKT-NBYUQASBSA-N |
| XLogP | 2.81 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |