C21H29N3OS — CID 166623067
[(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylsulfanyl-3-pyridinyl)methanone (PubChem CID 166623067) has the molecular formula C21H29N3OS and a molecular weight of 371.55 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylsulfanyl-3-pyridinyl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 166623067 |
| Molecular Formula | C21H29N3OS |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | [(1R,2S,6R,9R)-6-cyclopropyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylsulfanyl-3-pyridinyl)methanone |
| SMILES | CSc1ncccc1C(=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](C3CC3)N1C2 |
| InChI | InChI=1S/C21H29N3OS/c1-26-20-17(4-3-9-22-20)21(25)23-11-14-10-16(13-23)19-6-2-5-18(15-7-8-15)24(19)12-14/h3-4,9,14-16,18-19H,2,5-8,10-13H2,1H3/t14-,16+,18+,19-/m0/s1 |
| InChIKey | WNIFAUGNKJKIEF-WLWJZTKJSA-N |
| XLogP | 3.53 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |