C24H27F2N3O2 — CID 166614913
[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methoxy-3-pyridinyl)methanone (PubChem CID 166614913) has the molecular formula C24H27F2N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methoxy-3-pyridinyl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 166614913 |
| Molecular Formula | C24H27F2N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methoxy-3-pyridinyl)methanone |
| SMILES | COc1ncccc1C(=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](c3cc(F)cc(F)c3)N1C2 |
| InChI | InChI=1S/C24H27F2N3O2/c1-31-23-20(4-3-7-27-23)24(30)28-12-15-8-17(14-28)22-6-2-5-21(29(22)13-15)16-9-18(25)11-19(26)10-16/h3-4,7,9-11,15,17,21-22H,2,5-6,8,12-14H2,1H3/t15-,17+,21+,22-/m0/s1 |
| InChIKey | KACINCBBTLUPBS-NAYASGRBSA-N |
| XLogP | 4.06 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |