C22H26F2N4O2 — CID 165417670
3-[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 165417670) has the molecular formula C22H26F2N4O2 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 165417670 |
| Molecular Formula | C22H26F2N4O2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(C(=O)N2C[C@@H]3C[C@H](C2)[C@@H]2CCC[C@H](c4cc(F)cc(F)c4)N2C3)=NN1 |
| InChI | InChI=1S/C22H26F2N4O2/c23-16-7-14(8-17(24)9-16)19-2-1-3-20-15-6-13(11-28(19)20)10-27(12-15)22(30)18-4-5-21(29)26-25-18/h7-9,13,15,19-20H,1-6,10-12H2,(H,26,29)/t13-,15+,19+,20-/m0/s1 |
| InChIKey | ZKLVATRBNBKDHN-RVFRGNJDSA-N |
| XLogP | 2.60 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |