C22H26F2N4O — CID 165421011
[(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylpyrazol-3-yl)methanone (PubChem CID 165421011) has the molecular formula C22H26F2N4O and a molecular weight of 400.47 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylpyrazol-3-yl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 165421011 |
| Molecular Formula | C22H26F2N4O |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(1R,2S,6R,9R)-6-(3,5-difluorophenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(2-methylpyrazol-3-yl)methanone |
| SMILES | Cn1nccc1C(=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](c3cc(F)cc(F)c3)N1C2 |
| InChI | InChI=1S/C22H26F2N4O/c1-26-21(5-6-25-26)22(29)27-11-14-7-16(13-27)20-4-2-3-19(28(20)12-14)15-8-17(23)10-18(24)9-15/h5-6,8-10,14,16,19-20H,2-4,7,11-13H2,1H3/t14-,16+,19+,20-/m0/s1 |
| InChIKey | FBNMDGBPLFJRLK-NBPAUJCUSA-N |
| XLogP | 3.39 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |