C23H30N4O — CID 166618056
[(1R,2S,6R,9R)-6-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 166618056) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is [(1R,2S,6R,9R)-6-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [(1R,2S,6R,9R)-6-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 166618056 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2S,6R,9R)-6-benzyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)N1C[C@@H]2C[C@H](C1)[C@@H]1CCC[C@H](Cc3ccccc3)N1C2 |
| InChI | InChI=1S/C23H30N4O/c1-25-11-10-24-22(25)23(28)26-14-18-12-19(16-26)21-9-5-8-20(27(21)15-18)13-17-6-3-2-4-7-17/h2-4,6-7,10-11,18-21H,5,8-9,12-16H2,1H3/t18-,19+,20+,21-/m0/s1 |
| InChIKey | NLYQDOJGAMRRAS-BQJUDKOJSA-N |
| XLogP | 2.98 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |