C23H35N3O — CID 166614908
(2R)-2-amino-3-phenyl-1-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]propan-1-one (PubChem CID 166614908) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is (2R)-2-amino-3-phenyl-1-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]propan-1-one.
| Compound Name | (2R)-2-amino-3-phenyl-1-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]propan-1-one |
|---|---|
| PubChem CID | 166614908 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | (2R)-2-amino-3-phenyl-1-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]propan-1-one |
| SMILES | CCC[C@H]1CCC[C@H]2[C@@H]3C[C@@H](CN(C(=O)[C@H](N)Cc4ccccc4)C3)CN12 |
| InChI | InChI=1S/C23H35N3O/c1-2-7-20-10-6-11-22-19-12-18(15-26(20)22)14-25(16-19)23(27)21(24)13-17-8-4-3-5-9-17/h3-5,8-9,18-22H,2,6-7,10-16,24H2,1H3/t18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | BWSPHZIZCOOVSJ-PPGORRQASA-N |
| XLogP | 3.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |