C20H30N4O — CID 166619943
6-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide (PubChem CID 166619943) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 6-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide.
| Compound Name | 6-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166619943 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 6-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
| SMILES | CCC[C@H]1CCC[C@H]2[C@@H]3C[C@@H](CN(c4ccc(C(N)=O)cn4)C3)CN12 |
| InChI | InChI=1S/C20H30N4O/c1-2-4-17-5-3-6-18-16-9-14(12-24(17)18)11-23(13-16)19-8-7-15(10-22-19)20(21)25/h7-8,10,14,16-18H,2-6,9,11-13H2,1H3,(H2,21,25)/t14-,16+,17-,18-/m0/s1 |
| InChIKey | LKMNMLAFYLTVCP-RANZSIQMSA-N |
| XLogP | 2.66 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |