C23H32N2O3 — CID 166616740
2,3-dihydro-1,4-benzodioxin-5-yl-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 166616740) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-5-yl-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-5-yl-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 166616740 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-5-yl-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | CCC[C@H]1CCC[C@H]2[C@@H]3C[C@@H](CN(C(=O)c4cccc5c4OCCO5)C3)CN12 |
| InChI | InChI=1S/C23H32N2O3/c1-2-5-18-6-3-8-20-17-12-16(14-25(18)20)13-24(15-17)23(26)19-7-4-9-21-22(19)28-11-10-27-21/h4,7,9,16-18,20H,2-3,5-6,8,10-15H2,1H3/t16-,17+,18-,20-/m0/s1 |
| InChIKey | XWWKPJCXZWGKSR-DMUMMCEESA-N |
| XLogP | 3.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |