C25H33N3O2 — CID 166618315
(5-methyl-3-phenyl-1,2-oxazol-4-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone (PubChem CID 166618315) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (5-methyl-3-phenyl-1,2-oxazol-4-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone.
| Compound Name | (5-methyl-3-phenyl-1,2-oxazol-4-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
|---|---|
| PubChem CID | 166618315 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (5-methyl-3-phenyl-1,2-oxazol-4-yl)-[(1R,2S,6S,9R)-6-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]methanone |
| SMILES | CCC[C@H]1CCC[C@H]2[C@@H]3C[C@@H](CN(C(=O)c4c(-c5ccccc5)noc4C)C3)CN12 |
| InChI | InChI=1S/C25H33N3O2/c1-3-8-21-11-7-12-22-20-13-18(15-28(21)22)14-27(16-20)25(29)23-17(2)30-26-24(23)19-9-5-4-6-10-19/h4-6,9-10,18,20-22H,3,7-8,11-16H2,1-2H3/t18-,20+,21-,22-/m0/s1 |
| InChIKey | RCEYVQRYIUMVIG-FKVLARQCSA-N |
| XLogP | 4.77 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |