C20H29N3S — CID 166623872
(1R,2S,6R,9R)-6-cyclopropyl-11-(5-methylsulfanyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 166623872) has the molecular formula C20H29N3S and a molecular weight of 343.54 g/mol. Its IUPAC name is (1R,2S,6R,9R)-6-cyclopropyl-11-(5-methylsulfanyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,2S,6R,9R)-6-cyclopropyl-11-(5-methylsulfanyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 166623872 |
| Molecular Formula | C20H29N3S |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (1R,2S,6R,9R)-6-cyclopropyl-11-(5-methylsulfanyl-2-pyridinyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | CSc1ccc(N2C[C@@H]3C[C@H](C2)[C@@H]2CCC[C@H](C4CC4)N2C3)nc1 |
| InChI | InChI=1S/C20H29N3S/c1-24-17-7-8-20(21-10-17)22-11-14-9-16(13-22)19-4-2-3-18(15-5-6-15)23(19)12-14/h7-8,10,14-16,18-19H,2-6,9,11-13H2,1H3/t14-,16+,18+,19-/m0/s1 |
| InChIKey | PIMUPSZKBRWDDV-WLWJZTKJSA-N |
| XLogP | 3.89 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |