C19H27N5O2S — CID 134706927
2-methyl-4-(4-piperidin-1-ylsulfonyl-1,4-diazepan-1-yl)quinazoline (PubChem CID 134706927) has the molecular formula C19H27N5O2S and a molecular weight of 389.53 g/mol. Its IUPAC name is 2-methyl-4-(4-piperidin-1-ylsulfonyl-1,4-diazepan-1-yl)quinazoline.
| Compound Name | 2-methyl-4-(4-piperidin-1-ylsulfonyl-1,4-diazepan-1-yl)quinazoline |
|---|---|
| PubChem CID | 134706927 |
| Molecular Formula | C19H27N5O2S |
| Molecular Weight | 389.53 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-methyl-4-(4-piperidin-1-ylsulfonyl-1,4-diazepan-1-yl)quinazoline |
| SMILES | Cc1nc(N2CCCN(S(=O)(=O)N3CCCCC3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C19H27N5O2S/c1-16-20-18-9-4-3-8-17(18)19(21-16)22-10-7-13-24(15-14-22)27(25,26)23-11-5-2-6-12-23/h3-4,8-9H,2,5-7,10-15H2,1H3 |
| InChIKey | GBILECLKAJYNQH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |