C25H30FN5O2S — CID 92753675
2-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]-4-piperidin-1-ylquinazoline (PubChem CID 92753675) has the molecular formula C25H30FN5O2S and a molecular weight of 483.61 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]-4-piperidin-1-ylquinazoline.
| Compound Name | 2-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]-4-piperidin-1-ylquinazoline |
|---|---|
| PubChem CID | 92753675 |
| Molecular Formula | C25H30FN5O2S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 2-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]-4-piperidin-1-ylquinazoline |
| SMILES | C[C@H](c1nc(N2CCCCC2)c2ccccc2n1)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H30FN5O2S/c1-19(29-15-17-31(18-16-29)34(32,33)21-11-9-20(26)10-12-21)24-27-23-8-4-3-7-22(23)25(28-24)30-13-5-2-6-14-30/h3-4,7-12,19H,2,5-6,13-18H2,1H3/t19-/m1/s1 |
| InChIKey | KKJMUQNZTDKGEP-LJQANCHMSA-N |
| XLogP | 3.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |