C27H35N5O3S — CID 23632318
4-[2-[1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-yl]morpholine (PubChem CID 23632318) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is 4-[2-[1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-yl]morpholine.
| Compound Name | 4-[2-[1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-yl]morpholine |
|---|---|
| PubChem CID | 23632318 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 4-[2-[1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]ethyl]quinazolin-4-yl]morpholine |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(C(C)c3nc(N4CCOCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C27H35N5O3S/c1-20(2)22-8-10-23(11-9-22)36(33,34)32-14-12-30(13-15-32)21(3)26-28-25-7-5-4-6-24(25)27(29-26)31-16-18-35-19-17-31/h4-11,20-21H,12-19H2,1-3H3 |
| InChIKey | QZYBTDWWMPLSAZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |