C19H29FN2O2S — CID 134710382
1-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]-3-(methylsulfonylmethyl)piperidine (PubChem CID 134710382) has the molecular formula C19H29FN2O2S and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]-3-(methylsulfonylmethyl)piperidine.
| Compound Name | 1-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]-3-(methylsulfonylmethyl)piperidine |
|---|---|
| PubChem CID | 134710382 |
| Molecular Formula | C19H29FN2O2S |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]-3-(methylsulfonylmethyl)piperidine |
| SMILES | Cc1cc(F)ccc1N1CCC(N2CCCC(CS(C)(=O)=O)C2)CC1 |
| InChI | InChI=1S/C19H29FN2O2S/c1-15-12-17(20)5-6-19(15)21-10-7-18(8-11-21)22-9-3-4-16(13-22)14-25(2,23)24/h5-6,12,16,18H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | NFMWRLGNMYUTGB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |