C14H20FNO3S — CID 142832465
2-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]sulfonylethanol (PubChem CID 142832465) has the molecular formula C14H20FNO3S and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]sulfonylethanol.
| Compound Name | 2-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]sulfonylethanol |
|---|---|
| PubChem CID | 142832465 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[1-(4-fluoro-2-methylphenyl)piperidin-4-yl]sulfonylethanol |
| SMILES | Cc1cc(F)ccc1N1CCC(S(=O)(=O)CCO)CC1 |
| InChI | InChI=1S/C14H20FNO3S/c1-11-10-12(15)2-3-14(11)16-6-4-13(5-7-16)20(18,19)9-8-17/h2-3,10,13,17H,4-9H2,1H3 |
| InChIKey | KMSGYWNGNBGZOI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |