C16H23FN2O2S — CID 142832613
[1-(4-fluoro-2-methylphenyl)piperidin-4-yl] N-(2-methylsulfanylethyl)carbamate (PubChem CID 142832613) has the molecular formula C16H23FN2O2S and a molecular weight of 326.44 g/mol. Its IUPAC name is [1-(4-fluoro-2-methylphenyl)piperidin-4-yl] N-(2-methylsulfanylethyl)carbamate.
| Compound Name | [1-(4-fluoro-2-methylphenyl)piperidin-4-yl] N-(2-methylsulfanylethyl)carbamate |
|---|---|
| PubChem CID | 142832613 |
| Molecular Formula | C16H23FN2O2S |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [1-(4-fluoro-2-methylphenyl)piperidin-4-yl] N-(2-methylsulfanylethyl)carbamate |
| SMILES | CSCCNC(=O)OC1CCN(c2ccc(F)cc2C)CC1 |
| InChI | InChI=1S/C16H23FN2O2S/c1-12-11-13(17)3-4-15(12)19-8-5-14(6-9-19)21-16(20)18-7-10-22-2/h3-4,11,14H,5-10H2,1-2H3,(H,18,20) |
| InChIKey | FXNCBIZDRXIZGV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|