About 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one
3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one (PubChem CID 134711098) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one.
Molecular Properties
| Compound Name | 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one |
| PubChem CID | 134711098 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one |
| SMILES | CCC[C@]1(CO)CN(Cc2coc3ccccc3c2=O)CC[C@@H]1O |
| InChI | InChI=1S/C19H25NO4/c1-2-8-19(13-21)12-20(9-7-17(19)22)10-14-11-24-16-6-4-3-5-15(16)18(14)23/h3-6,11,17,21-22H,2,7-10,12-13H2,1H3/t17-,19+/m0/s1 |
| InChIKey | XCQSGRCPLNVGJN-PKOBYXMFSA-N |
| XLogP | 2.14 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one?
The IUPAC name of 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one (CID 134711098) is 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one.
What is the SMILES notation for 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one?
The canonical SMILES for 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one is CCC[C@]1(CO)CN(Cc2coc3ccccc3c2=O)CC[C@@H]1O.
What is the InChIKey of 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one?
The InChIKey is XCQSGRCPLNVGJN-PKOBYXMFSA-N. The full InChI is InChI=1S/C19H25NO4/c1-2-8-19(13-21)12-20(9-7-17(19)22)10-14-11-24-16-6-4-3-5-15(16)18(14)23/h3-6,11,17,21-22H,2,7-10,12-13H2,1H3/t17-,19+/m0/s1.
What are the key properties of 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one?
3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one has a molecular weight of 331.41 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3R,4S)-4-hydroxy-3-(hydroxymethyl)-3-propylpiperidin-1-yl]methyl]chromen-4-one is sourced from PubChem (CID 134711098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).