About (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol
(3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol (PubChem CID 155509305) has the molecular formula C18H29NO4
and a molecular weight of 323.43 g/mol. Its IUPAC name is (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol.
Molecular Properties
| Compound Name | (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol |
| PubChem CID | 155509305 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol |
| SMILES | CCC[C@@]1(CO)CN(Cc2cc(OC)cc(OC)c2)CC[C@H]1O |
| InChI | InChI=1S/C18H29NO4/c1-4-6-18(13-20)12-19(7-5-17(18)21)11-14-8-15(22-2)10-16(9-14)23-3/h8-10,17,20-21H,4-7,11-13H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | QLVAZPAOJUHROH-MSOLQXFVSA-N |
| XLogP | 2.05 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol?
The IUPAC name of (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol (CID 155509305) is (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol.
What is the SMILES notation for (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol?
The canonical SMILES for (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol is CCC[C@@]1(CO)CN(Cc2cc(OC)cc(OC)c2)CC[C@H]1O.
What is the InChIKey of (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol?
The InChIKey is QLVAZPAOJUHROH-MSOLQXFVSA-N. The full InChI is InChI=1S/C18H29NO4/c1-4-6-18(13-20)12-19(7-5-17(18)21)11-14-8-15(22-2)10-16(9-14)23-3/h8-10,17,20-21H,4-7,11-13H2,1-3H3/t17-,18+/m1/s1.
What are the key properties of (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol?
(3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol has a molecular weight of 323.43 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-1-[(3,5-dimethoxyphenyl)methyl]-3-(hydroxymethyl)-3-propylpiperidin-4-ol is sourced from PubChem (CID 155509305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).