C16H20N2O5 — CID 134711907
(2S,3R)-N-cyclopropyl-3-(3,4-dimethoxyphenyl)-5-oxomorpholine-2-carboxamide (PubChem CID 134711907) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is (2S,3R)-N-cyclopropyl-3-(3,4-dimethoxyphenyl)-5-oxomorpholine-2-carboxamide.
| Compound Name | (2S,3R)-N-cyclopropyl-3-(3,4-dimethoxyphenyl)-5-oxomorpholine-2-carboxamide |
|---|---|
| PubChem CID | 134711907 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (2S,3R)-N-cyclopropyl-3-(3,4-dimethoxyphenyl)-5-oxomorpholine-2-carboxamide |
| SMILES | COc1ccc([C@H]2NC(=O)CO[C@@H]2C(=O)NC2CC2)cc1OC |
| InChI | InChI=1S/C16H20N2O5/c1-21-11-6-3-9(7-12(11)22-2)14-15(23-8-13(19)18-14)16(20)17-10-4-5-10/h3,6-7,10,14-15H,4-5,8H2,1-2H3,(H,17,20)(H,18,19)/t14-,15+/m1/s1 |
| InChIKey | MKJPKRURZFIVKE-CABCVRRESA-N |
| XLogP | 0.54 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |