C15H20N2O4 — CID 134696775
(2S,3R)-N-(3-methoxypropyl)-5-oxo-3-phenylmorpholine-2-carboxamide (PubChem CID 134696775) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (2S,3R)-N-(3-methoxypropyl)-5-oxo-3-phenylmorpholine-2-carboxamide.
| Compound Name | (2S,3R)-N-(3-methoxypropyl)-5-oxo-3-phenylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 134696775 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2S,3R)-N-(3-methoxypropyl)-5-oxo-3-phenylmorpholine-2-carboxamide |
| SMILES | COCCCNC(=O)[C@H]1OCC(=O)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-9-5-8-16-15(19)14-13(17-12(18)10-21-14)11-6-3-2-4-7-11/h2-4,6-7,13-14H,5,8-10H2,1H3,(H,16,19)(H,17,18)/t13-,14+/m1/s1 |
| InChIKey | JVAWJHUTCFHFAK-KGLIPLIRSA-N |
| XLogP | 0.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|