C19H24N2O4 — CID 134712158
2-[[3-(dimethylamino)-3-oxopropyl]-methylamino]-2-(6-methoxynaphthalen-2-yl)acetic acid (PubChem CID 134712158) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[[3-(dimethylamino)-3-oxopropyl]-methylamino]-2-(6-methoxynaphthalen-2-yl)acetic acid.
| Compound Name | 2-[[3-(dimethylamino)-3-oxopropyl]-methylamino]-2-(6-methoxynaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 134712158 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[[3-(dimethylamino)-3-oxopropyl]-methylamino]-2-(6-methoxynaphthalen-2-yl)acetic acid |
| SMILES | COc1ccc2cc(C(C(=O)O)N(C)CCC(=O)N(C)C)ccc2c1 |
| InChI | InChI=1S/C19H24N2O4/c1-20(2)17(22)9-10-21(3)18(19(23)24)15-6-5-14-12-16(25-4)8-7-13(14)11-15/h5-8,11-12,18H,9-10H2,1-4H3,(H,23,24) |
| InChIKey | ZDVKTCKFUQPQDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |