C15H28N2O2 — CID 134712395
(3aS,5S,6R,7aR)-2-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol (PubChem CID 134712395) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (3aS,5S,6R,7aR)-2-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol.
| Compound Name | (3aS,5S,6R,7aR)-2-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
|---|---|
| PubChem CID | 134712395 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (3aS,5S,6R,7aR)-2-[(1-ethylpyrrolidin-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-5,6-diol |
| SMILES | CCN1CCCC1CN1C[C@H]2C[C@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C15H28N2O2/c1-2-17-5-3-4-13(17)10-16-8-11-6-14(18)15(19)7-12(11)9-16/h11-15,18-19H,2-10H2,1H3/t11-,12+,13?,14+,15- |
| InChIKey | KFFNWGFISQBBDO-IRWZXODSSA-N |
| XLogP | 0.53 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |