C16H27N3O — CID 134712578
2-[3-[[methyl-[(2-methyl-3-pyridinyl)methyl]amino]methyl]piperidin-1-yl]ethanol (PubChem CID 134712578) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[3-[[methyl-[(2-methyl-3-pyridinyl)methyl]amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[3-[[methyl-[(2-methyl-3-pyridinyl)methyl]amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 134712578 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2-[3-[[methyl-[(2-methyl-3-pyridinyl)methyl]amino]methyl]piperidin-1-yl]ethanol |
| SMILES | Cc1ncccc1CN(C)CC1CCCN(CCO)C1 |
| InChI | InChI=1S/C16H27N3O/c1-14-16(6-3-7-17-14)13-18(2)11-15-5-4-8-19(12-15)9-10-20/h3,6-7,15,20H,4-5,8-13H2,1-2H3 |
| InChIKey | XJAYMIQEUXRRMP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |