C19H29N3O — CID 95143050
2-[(3R)-3-[[methyl-[(1-methylindol-3-yl)methyl]amino]methyl]piperidin-1-yl]ethanol (PubChem CID 95143050) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[(3R)-3-[[methyl-[(1-methylindol-3-yl)methyl]amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[[methyl-[(1-methylindol-3-yl)methyl]amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 95143050 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 2-[(3R)-3-[[methyl-[(1-methylindol-3-yl)methyl]amino]methyl]piperidin-1-yl]ethanol |
| SMILES | CN(Cc1cn(C)c2ccccc12)C[C@H]1CCCN(CCO)C1 |
| InChI | InChI=1S/C19H29N3O/c1-20(12-16-6-5-9-22(13-16)10-11-23)14-17-15-21(2)19-8-4-3-7-18(17)19/h3-4,7-8,15-16,23H,5-6,9-14H2,1-2H3/t16-/m1/s1 |
| InChIKey | UINVVESXNNCCJD-MRXNPFEDSA-N |
| XLogP | 2.31 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |