C13H14FN3O2 — CID 134714010
N-(1,3-dimethylpyrazol-4-yl)-3-fluoro-4-methoxybenzamide (PubChem CID 134714010) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-3-fluoro-4-methoxybenzamide.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 134714010 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-3-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cn(C)nc2C)cc1F |
| InChI | InChI=1S/C13H14FN3O2/c1-8-11(7-17(2)16-8)15-13(18)9-4-5-12(19-3)10(14)6-9/h4-7H,1-3H3,(H,15,18) |
| InChIKey | DEGUTIZOHZLWIW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |