C24H21N3O2 — CID 134715975
(4R)-4,6-dibenzyl-2-imino-7-methyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carbonitrile (PubChem CID 134715975) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (4R)-4,6-dibenzyl-2-imino-7-methyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carbonitrile.
| Compound Name | (4R)-4,6-dibenzyl-2-imino-7-methyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134715975 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (4R)-4,6-dibenzyl-2-imino-7-methyl-5-oxo-3,4-dihydropyrano[3,2-c]pyridine-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2cc(C)n(Cc3ccccc3)c(=O)c2[C@H](Cc2ccccc2)C1C#N |
| InChI | InChI=1S/C24H21N3O2/c1-16-12-21-22(24(28)27(16)15-18-10-6-3-7-11-18)19(20(14-25)23(26)29-21)13-17-8-4-2-5-9-17/h2-12,19-20,26H,13,15H2,1H3/b26-23-/t19-,20?/m1/s1 |
| InChIKey | ZVHLIXPZTJKBIU-YJOFWFLWSA-N |
| XLogP | 4.04 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|