C20H15N3O2 — CID 91076282
2-imino-6-methyl-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile (PubChem CID 91076282) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-imino-6-methyl-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile.
| Compound Name | 2-imino-6-methyl-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 91076282 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-imino-6-methyl-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-3-carbonitrile |
| SMILES | [H]/N=C1\Oc2c(c(=O)n(C)c3ccccc23)C(c2ccccc2)C1C#N |
| InChI | InChI=1S/C20H15N3O2/c1-23-15-10-6-5-9-13(15)18-17(20(23)24)16(12-7-3-2-4-8-12)14(11-21)19(22)25-18/h2-10,14,16,22H,1H3/b22-19- |
| InChIKey | DFSQKVSWQGIUJL-QOCHGBHMSA-N |
| XLogP | 3.18 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|