C19H15NO3 — CID 4920638
6-methyl-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-2,5-dione (PubChem CID 4920638) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is 6-methyl-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 6-methyl-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 4920638 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 6-methyl-4-phenyl-3,4-dihydropyrano[3,2-c]quinoline-2,5-dione |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(=O)CC2c1ccccc1 |
| InChI | InChI=1S/C19H15NO3/c1-20-15-10-6-5-9-13(15)18-17(19(20)22)14(11-16(21)23-18)12-7-3-2-4-8-12/h2-10,14H,11H2,1H3 |
| InChIKey | CXXGLFBLMAVACZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |