C30H30N2O4 — CID 5319347
(1S,14S,26R)-4,13,13,23-tetramethyl-26-(2-methylprop-1-enyl)-12,15-dioxa-4,23-diazahexacyclo[12.12.0.02,11.05,10.016,25.017,22]hexacosa-2(11),5,7,9,16(25),17,19,21-octaene-3,24-dione (PubChem CID 5319347) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (1S,14S,26R)-4,13,13,23-tetramethyl-26-(2-methylprop-1-enyl)-12,15-dioxa-4,23-diazahexacyclo[12.12.0.02,11.05,10.016,25.017,22]hexacosa-2(11),5,7,9,16(25),17,19,21-octaene-3,24-dione.
| Compound Name | (1S,14S,26R)-4,13,13,23-tetramethyl-26-(2-methylprop-1-enyl)-12,15-dioxa-4,23-diazahexacyclo[12.12.0.02,11.05,10.016,25.017,22]hexacosa-2(11),5,7,9,16(25),17,19,21-octaene-3,24-dione |
|---|---|
| PubChem CID | 5319347 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (1S,14S,26R)-4,13,13,23-tetramethyl-26-(2-methylprop-1-enyl)-12,15-dioxa-4,23-diazahexacyclo[12.12.0.02,11.05,10.016,25.017,22]hexacosa-2(11),5,7,9,16(25),17,19,21-octaene-3,24-dione |
| SMILES | CC(C)=C[C@H]1c2c(c3ccccc3n(C)c2=O)O[C@H]2[C@@H]1c1c(c3ccccc3n(C)c1=O)OC2(C)C |
| InChI | InChI=1S/C30H30N2O4/c1-16(2)15-19-22-24-26(18-12-8-10-14-21(18)32(6)29(24)34)36-30(3,4)27(22)35-25-17-11-7-9-13-20(17)31(5)28(33)23(19)25/h7-15,19,22,27H,1-6H3/t19-,22+,27+/m1/s1 |
| InChIKey | CXLHMCJQURZLAW-SWGGMNADSA-N |
| XLogP | 5.16 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|