C23H16Cl2N2O4S — CID 1347170
1-(2,3-dichlorophenyl)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1347170) has the molecular formula C23H16Cl2N2O4S and a molecular weight of 487.36 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(2,3-dichlorophenyl)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1347170 |
| Molecular Formula | C23H16Cl2N2O4S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.02 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-5-[(2,7-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc2ccc(OC)c(C=C3C(=O)NC(=S)N(c4cccc(Cl)c4Cl)C3=O)c2c1 |
| InChI | InChI=1S/C23H16Cl2N2O4S/c1-30-13-8-6-12-7-9-19(31-2)15(14(12)10-13)11-16-21(28)26-23(32)27(22(16)29)18-5-3-4-17(24)20(18)25/h3-11H,1-2H3,(H,26,28,32) |
| InChIKey | UMXFTHYYYFHCNU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|