C46H80NO10P — CID 134718071
(2S)-2-amino-3-[hydroxy-[(2R)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134718071) has the molecular formula C46H80NO10P and a molecular weight of 838.12 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134718071 |
| Molecular Formula | C46H80NO10P |
| Molecular Weight | 838.12 g/mol |
| Exact Mass | 837.55 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(11E,14E)-icosa-11,14-dienoyl]oxy-2-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C46H80NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-44(48)54-39-42(40-55-58(52,53)56-41-43(47)46(50)51)57-45(49)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,24,26,30,32,42-43H,3-10,12,14-16,21-23,25,27-29,31,33-41,47H2,1-2H3,(H,50,51)(H,52,53)/b13-11+,19-17+,20-18+,26-24+,32-30+/t42-,43+/m1/s1 |
| InChIKey | AGLHGKZALKYGLY-BBUAUPLKSA-N |
| XLogP | 11.95 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.12 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|