C41H72NO10P — CID 134723583
(2R)-2-amino-3-[hydroxy-[(2S)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134723583) has the molecular formula C41H72NO10P and a molecular weight of 770.00 g/mol. Its IUPAC name is (2R)-2-amino-3-[hydroxy-[(2S)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[hydroxy-[(2S)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134723583 |
| Molecular Formula | C41H72NO10P |
| Molecular Weight | 770.00 g/mol |
| Exact Mass | 769.49 |
| IUPAC Name | (2R)-2-amino-3-[hydroxy-[(2S)-3-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-2-[(E)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/CCCCCCCC(=O)O[C@@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)OC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C41H72NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-39(43)49-34-37(35-50-53(47,48)51-36-38(42)41(45)46)52-40(44)33-31-29-27-25-22-16-14-12-10-8-6-4-2/h12,14,17-18,20-21,24,26,37-38H,3-11,13,15-16,19,22-23,25,27-36,42H2,1-2H3,(H,45,46)(H,47,48)/b14-12+,18-17+,21-20+,26-24+/t37-,38+/m0/s1 |
| InChIKey | CEPOXOPWDKSWQQ-NDODIHGKSA-N |
| XLogP | 10.22 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.00 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|