C32H61NO3 — CID 134718796
(E)-N-[(E,2S,3R)-1,3-dihydroxypentadec-8-en-2-yl]heptadec-9-enamide (PubChem CID 134718796) has the molecular formula C32H61NO3 and a molecular weight of 507.84 g/mol. Its IUPAC name is (E)-N-[(E,2S,3R)-1,3-dihydroxypentadec-8-en-2-yl]heptadec-9-enamide.
| Compound Name | (E)-N-[(E,2S,3R)-1,3-dihydroxypentadec-8-en-2-yl]heptadec-9-enamide |
|---|---|
| PubChem CID | 134718796 |
| Molecular Formula | C32H61NO3 |
| Molecular Weight | 507.84 g/mol |
| Exact Mass | 507.47 |
| IUPAC Name | (E)-N-[(E,2S,3R)-1,3-dihydroxypentadec-8-en-2-yl]heptadec-9-enamide |
| SMILES | CCCCCC/C=C/CCCC[C@@H](O)[C@H](CO)NC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C32H61NO3/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-32(36)33-30(29-34)31(35)27-25-23-21-19-14-12-10-8-6-4-2/h14-16,19,30-31,34-35H,3-13,17-18,20-29H2,1-2H3,(H,33,36)/b16-15+,19-14+/t30-,31+/m0/s1 |
| InChIKey | ANGJPTHZBHFSQN-UTSZUENLSA-N |
| XLogP | 8.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.84 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|