C35H67NO3 — CID 134728234
(E)-N-[(E,2S,3R)-1,3-dihydroxyheptadec-8-en-2-yl]octadec-9-enamide (PubChem CID 134728234) has the molecular formula C35H67NO3 and a molecular weight of 549.93 g/mol. Its IUPAC name is (E)-N-[(E,2S,3R)-1,3-dihydroxyheptadec-8-en-2-yl]octadec-9-enamide.
| Compound Name | (E)-N-[(E,2S,3R)-1,3-dihydroxyheptadec-8-en-2-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 134728234 |
| Molecular Formula | C35H67NO3 |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 549.51 |
| IUPAC Name | (E)-N-[(E,2S,3R)-1,3-dihydroxyheptadec-8-en-2-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)N[C@@H](CO)[C@H](O)CCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C35H67NO3/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-35(39)36-33(32-37)34(38)30-28-26-24-22-20-16-14-12-10-8-6-4-2/h17-18,20,22,33-34,37-38H,3-16,19,21,23-32H2,1-2H3,(H,36,39)/b18-17+,22-20+/t33-,34+/m0/s1 |
| InChIKey | DWEJSAOMYNATRL-ZFRVLOIRSA-N |
| XLogP | 9.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|