C50H87NO7 — CID 134722746
4-[2-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134722746) has the molecular formula C50H87NO7 and a molecular weight of 814.25 g/mol. Its IUPAC name is 4-[2-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134722746 |
| Molecular Formula | C50H87NO7 |
| Molecular Weight | 814.25 g/mol |
| Exact Mass | 813.65 |
| IUPAC Name | 4-[2-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-3-[(7E,9E)-nonadeca-7,9-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCC/C=C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C50H87NO7/c1-6-8-10-12-14-16-18-20-22-24-25-27-29-31-33-35-37-39-41-49(53)58-46(44-56-43-42-47(50(54)55)51(3,4)5)45-57-48(52)40-38-36-34-32-30-28-26-23-21-19-17-15-13-11-9-7-2/h18,20,22-28,30,46-47H,6-17,19,21,29,31-45H2,1-5H3/b20-18+,24-22+,26-23+,27-25+,30-28+ |
| InChIKey | BXHOJHFIIPNMDE-QOMZKFKQSA-N |
| XLogP | 11.64 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.25 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|