C42H73NO7 — CID 134784954
4-[2-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134784954) has the molecular formula C42H73NO7 and a molecular weight of 704.05 g/mol. Its IUPAC name is 4-[2-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134784954 |
| Molecular Formula | C42H73NO7 |
| Molecular Weight | 704.05 g/mol |
| Exact Mass | 703.54 |
| IUPAC Name | 4-[2-[(9E,11E,13E,15E)-henicosa-9,11,13,15-tetraenoyl]oxy-3-undecanoyloxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C42H73NO7/c1-6-8-10-12-14-16-17-18-19-20-21-22-23-24-25-27-29-31-33-41(45)50-38(36-48-35-34-39(42(46)47)43(3,4)5)37-49-40(44)32-30-28-26-15-13-11-9-7-2/h14,16-22,38-39H,6-13,15,23-37H2,1-5H3/b16-14+,18-17+,20-19+,22-21+ |
| InChIKey | ZOUFMJLFZFPIPL-BAMHHROUSA-N |
| XLogP | 8.74 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.05 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|