C38H72NO8P — CID 134724195
[(2R)-3-decanoyloxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134724195) has the molecular formula C38H72NO8P and a molecular weight of 701.97 g/mol. Its IUPAC name is [(2R)-3-decanoyloxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-decanoyloxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134724195 |
| Molecular Formula | C38H72NO8P |
| Molecular Weight | 701.97 g/mol |
| Exact Mass | 701.50 |
| IUPAC Name | [(2R)-3-decanoyloxy-2-[(11E,14E)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C38H72NO8P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-27-29-31-38(41)47-36(35-46-48(42,43)45-33-32-39(3,4)5)34-44-37(40)30-28-26-24-13-11-9-7-2/h14-15,17-18,36H,6-13,16,19-35H2,1-5H3/b15-14+,18-17+/t36-/m1/s1 |
| InChIKey | CKJMWPGKTKCMJP-APUSQCGUSA-N |
| XLogP | 9.38 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.97 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|