C35H57O8P — CID 134726062
[(2R)-1-decanoyloxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 134726062) has the molecular formula C35H57O8P and a molecular weight of 636.81 g/mol. Its IUPAC name is [(2R)-1-decanoyloxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-decanoyloxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 134726062 |
| Molecular Formula | C35H57O8P |
| Molecular Weight | 636.81 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | [(2R)-1-decanoyloxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C35H57O8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-28-30-35(37)43-33(32-42-44(38,39)40)31-41-34(36)29-27-25-23-10-8-6-4-2/h5,7,11-12,14-15,17-18,20-21,24,26,33H,3-4,6,8-10,13,16,19,22-23,25,27-32H2,1-2H3,(H2,38,39,40)/b7-5+,12-11+,15-14+,18-17+,21-20+,26-24+/t33-/m1/s1 |
| InChIKey | DBNLHBVMRBRELG-WXIMSMDWSA-N |
| XLogP | 9.17 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.81 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|