C43H69O8P — CID 134747187
[(2R)-1-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 134747187) has the molecular formula C43H69O8P and a molecular weight of 744.99 g/mol. Its IUPAC name is [(2R)-1-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 134747187 |
| Molecular Formula | C43H69O8P |
| Molecular Weight | 744.99 g/mol |
| Exact Mass | 744.47 |
| IUPAC Name | [(2R)-1-[(9E,12E)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/C/C=C/CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H69O8P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-36-38-43(45)51-41(40-50-52(46,47)48)39-49-42(44)37-35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-19,21-23,26,28,32,34,41H,3-4,6,8-10,15-16,20,24-25,27,29-31,33,35-40H2,1-2H3,(H2,46,47,48)/b7-5+,13-11+,14-12+,19-17+,22-21+,23-18+,28-26+,34-32+/t41-/m1/s1 |
| InChIKey | LMRGXWKSGCXJBV-FCIUMHKVSA-N |
| XLogP | 11.84 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.99 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|