C45H71O8P — CID 134761882
[(2R)-1-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 134761882) has the molecular formula C45H71O8P and a molecular weight of 771.03 g/mol. Its IUPAC name is [(2R)-1-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2R)-1-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 134761882 |
| Molecular Formula | C45H71O8P |
| Molecular Weight | 771.03 g/mol |
| Exact Mass | 770.49 |
| IUPAC Name | [(2R)-1-[(5E,8E,11E)-icosa-5,8,11-trienoyl]oxy-3-phosphonooxypropan-2-yl] (4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C45H71O8P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-45(47)53-43(42-52-54(48,49)50)41-51-44(46)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17-20,22,24-25,27-28,30-31,33-34,36,43H,3-4,6,8-10,12,14-16,21,23,26,29,32,35,37-42H2,1-2H3,(H2,48,49,50)/b7-5+,13-11+,19-17+,20-18+,24-22+,27-25+,30-28+,33-31+,36-34+/t43-/m1/s1 |
| InChIKey | QQTMAILUUKBEBP-IMPQVUPXSA-N |
| XLogP | 12.40 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.03 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|