C41H76NO7+ — CID 134727678
[1-carboxy-3-[2-[(E)-heptadec-7-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134727678) has the molecular formula C41H76NO7+ and a molecular weight of 695.06 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(E)-heptadec-7-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(E)-heptadec-7-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134727678 |
| Molecular Formula | C41H76NO7+ |
| Molecular Weight | 695.06 g/mol |
| Exact Mass | 694.56 |
| IUPAC Name | [1-carboxy-3-[2-[(E)-heptadec-7-enoyl]oxy-3-[(E)-tetradec-9-enoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C41H75NO7/c1-6-8-10-12-14-16-18-19-20-22-24-26-28-30-32-40(44)49-37(35-47-34-33-38(41(45)46)42(3,4)5)36-48-39(43)31-29-27-25-23-21-17-15-13-11-9-7-2/h13,15,20,22,37-38H,6-12,14,16-19,21,23-36H2,1-5H3/p+1/b15-13+,22-20+ |
| InChIKey | DQTPVJCQADBHRZ-OSVJMXPLSA-O |
| XLogP | 10.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.06 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|