C35H66NO7+ — CID 134767095
[1-carboxy-3-[2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium (PubChem CID 134767095) has the molecular formula C35H66NO7+ and a molecular weight of 612.91 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134767095 |
| Molecular Formula | C35H66NO7+ |
| Molecular Weight | 612.91 g/mol |
| Exact Mass | 612.48 |
| IUPAC Name | [1-carboxy-3-[2-[(E)-tetradec-9-enoyl]oxy-3-undecanoyloxypropoxy]propyl]-trimethylazanium |
| SMILES | CCCC/C=C/CCCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C35H65NO7/c1-6-8-10-12-14-16-17-18-20-22-24-26-34(38)43-31(29-41-28-27-32(35(39)40)36(3,4)5)30-42-33(37)25-23-21-19-15-13-11-9-7-2/h12,14,31-32H,6-11,13,15-30H2,1-5H3/p+1/b14-12+ |
| InChIKey | SLSMBAZOWRFGGS-WYMLVPIESA-O |
| XLogP | 8.02 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.91 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|