C46H83N2O6P — CID 134729301
[(2S,3R,4E,8E)-3-hydroxy-2-[[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 134729301) has the molecular formula C46H83N2O6P and a molecular weight of 791.15 g/mol. Its IUPAC name is [(2S,3R,4E,8E)-3-hydroxy-2-[[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S,3R,4E,8E)-3-hydroxy-2-[[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 134729301 |
| Molecular Formula | C46H83N2O6P |
| Molecular Weight | 791.15 g/mol |
| Exact Mass | 790.60 |
| IUPAC Name | [(2S,3R,4E,8E)-3-hydroxy-2-[[(5E,8E,11E,14E)-tetracosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C/CC/C=C/[C@@H](O)[C@H](COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC |
| InChI | InChI=1S/C46H83N2O6P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-28-30-32-34-36-38-40-46(50)47-44(43-54-55(51,52)53-42-41-48(3,4)5)45(49)39-37-35-33-31-29-19-17-15-13-11-9-7-2/h21-22,24-25,27-29,31-32,34,37,39,44-45,49H,6-20,23,26,30,33,35-36,38,40-43H2,1-5H3,(H-,47,50,51,52)/b22-21+,25-24+,28-27+,31-29+,34-32+,39-37+/t44-,45+/m0/s1 |
| InChIKey | FFNMYWMPKUBXBW-ITYVUTRNSA-N |
| XLogP | 11.39 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.15 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|