C46H81O13P — CID 134729426
[(2S)-2-[(E)-heptadec-9-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (8E,11E,14E)-icosa-8,11,14-trienoate (PubChem CID 134729426) has the molecular formula C46H81O13P and a molecular weight of 873.11 g/mol. Its IUPAC name is [(2S)-2-[(E)-heptadec-9-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (8E,11E,14E)-icosa-8,11,14-trienoate.
| Compound Name | [(2S)-2-[(E)-heptadec-9-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (8E,11E,14E)-icosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 134729426 |
| Molecular Formula | C46H81O13P |
| Molecular Weight | 873.11 g/mol |
| Exact Mass | 872.54 |
| IUPAC Name | [(2S)-2-[(E)-heptadec-9-enoyl]oxy-3-[hydroxy-[(5S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxypropyl] (8E,11E,14E)-icosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCCCC(=O)OC[C@@H](COP(=O)(O)OC1C(O)C(O)C(O)[C@H](O)C1O)OC(=O)CCCCCCC/C=C/CCCCCCC |
| InChI | InChI=1S/C46H81O13P/c1-3-5-7-9-11-13-15-17-19-20-21-23-24-26-28-30-32-34-39(47)56-36-38(37-57-60(54,55)59-46-44(52)42(50)41(49)43(51)45(46)53)58-40(48)35-33-31-29-27-25-22-18-16-14-12-10-8-6-4-2/h11,13,16-19,21,23,38,41-46,49-53H,3-10,12,14-15,20,22,24-37H2,1-2H3,(H,54,55)/b13-11+,18-16+,19-17+,23-21+/t38-,41?,42-,43?,44?,45?,46?/m0/s1 |
| InChIKey | FGSKHHDSGGTVCD-KEZOXMGSSA-N |
| XLogP | 8.78 |
| TPSA | 209.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.11 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|